About N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide (PubChem CID 18789968) has the molecular formula C20H27FN2O5S
and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide |
| PubChem CID | 18789968 |
| Molecular Formula | C20H27FN2O5S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide |
| SMILES | COc1ccc(CCN(C)CCOc2ccc(NS(C)(=O)=O)cc2F)cc1OC |
| InChI | InChI=1S/C20H27FN2O5S/c1-23(10-9-15-5-7-19(26-2)20(13-15)27-3)11-12-28-18-8-6-16(14-17(18)21)22-29(4,24)25/h5-8,13-14,22H,9-12H2,1-4H3 |
| InChIKey | QLIFUALSJGRAKX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide?
The IUPAC name of N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide (CID 18789968) is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide?
The canonical SMILES for N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide is COc1ccc(CCN(C)CCOc2ccc(NS(C)(=O)=O)cc2F)cc1OC.
What is the InChIKey of N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide?
The InChIKey is QLIFUALSJGRAKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27FN2O5S/c1-23(10-9-15-5-7-19(26-2)20(13-15)27-3)11-12-28-18-8-6-16(14-17(18)21)22-29(4,24)25/h5-8,13-14,22H,9-12H2,1-4H3.
What are the key properties of N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide?
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide has a molecular weight of 426.51 g/mol, XLogP of 2.77, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]-3-fluorophenyl]methanesulfonamide is sourced from PubChem (CID 18789968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).