About 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole
1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole (PubChem CID 18790429) has the molecular formula C11H12N4O4S
and a molecular weight of 296.31 g/mol. Its IUPAC name is 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole.
Molecular Properties
| Compound Name | 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole |
| PubChem CID | 18790429 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2cnnn2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C11H12N4O4S/c1-7-4-8(2)11(9(3)5-7)20(18,19)10-6-12-13-14(10)15(16)17/h4-6H,1-3H3 |
| InChIKey | FJAQALABWRFFGE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole?
The IUPAC name of 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole (CID 18790429) is 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole.
What is the SMILES notation for 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole?
The canonical SMILES for 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole is Cc1cc(C)c(S(=O)(=O)c2cnnn2[N+](=O)[O-])c(C)c1.
What is the InChIKey of 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole?
The InChIKey is FJAQALABWRFFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O4S/c1-7-4-8(2)11(9(3)5-7)20(18,19)10-6-12-13-14(10)15(16)17/h4-6H,1-3H3.
What are the key properties of 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole?
1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole has a molecular weight of 296.31 g/mol, XLogP of 1.08, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-5-(2,4,6-trimethylphenyl)sulfonyltriazole is sourced from PubChem (CID 18790429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).