10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid

C14H23NO5 — CID 18790434

IUPAC10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid
SMILESO=C(O)CCCCCCCCCN1C(=O)CC(O)C1=O
InChIInChI=1S/C14H23NO5/c16-11-10-12(17)15(14(11)20)9-7-5-3-1-2-4-6-8-13(18)19/h11,16H,1-10H2,(H,18,19)
InChIKeyRQTKXCXHRORPCK-UHFFFAOYSA-N
MW285.34 g/mol
LogP1.31
Rot. Bonds10

About 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid

10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid (PubChem CID 18790434) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid.

Molecular Properties

Compound Name10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid
PubChem CID18790434
Molecular FormulaC14H23NO5
Molecular Weight285.34 g/mol
Exact Mass285.16
IUPAC Name10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid
SMILESO=C(O)CCCCCCCCCN1C(=O)CC(O)C1=O
InChIInChI=1S/C14H23NO5/c16-11-10-12(17)15(14(11)20)9-7-5-3-1-2-4-6-8-13(18)19/h11,16H,1-10H2,(H,18,19)
InChIKeyRQTKXCXHRORPCK-UHFFFAOYSA-N
XLogP1.31
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.34
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid?
The IUPAC name of 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid (CID 18790434) is 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid.
What is the SMILES notation for 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid?
The canonical SMILES for 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid is O=C(O)CCCCCCCCCN1C(=O)CC(O)C1=O.
What is the InChIKey of 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid?
The InChIKey is RQTKXCXHRORPCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO5/c16-11-10-12(17)15(14(11)20)9-7-5-3-1-2-4-6-8-13(18)19/h11,16H,1-10H2,(H,18,19).
What are the key properties of 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid?
10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid has a molecular weight of 285.34 g/mol, XLogP of 1.31, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-hydroxy-2,5-dioxopyrrolidin-1-yl)decanoic acid is sourced from PubChem (CID 18790434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).