C13H12Br2O3 — CID 18790706
ethyl 2-(2,2-dibromo-1-oxo-3H-inden-5-yl)acetate (PubChem CID 18790706) has the molecular formula C13H12Br2O3 and a molecular weight of 376.04 g/mol. Its IUPAC name is ethyl 2-(2,2-dibromo-1-oxo-3H-inden-5-yl)acetate.
| Compound Name | ethyl 2-(2,2-dibromo-1-oxo-3H-inden-5-yl)acetate |
|---|---|
| PubChem CID | 18790706 |
| Molecular Formula | C13H12Br2O3 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | ethyl 2-(2,2-dibromo-1-oxo-3H-inden-5-yl)acetate |
| SMILES | CCOC(=O)Cc1ccc2c(c1)CC(Br)(Br)C2=O |
| InChI | InChI=1S/C13H12Br2O3/c1-2-18-11(16)6-8-3-4-10-9(5-8)7-13(14,15)12(10)17/h3-5H,2,6-7H2,1H3 |
| InChIKey | LFBDWMPRTSHYLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|