About 1,1'-biphenyl azide
1,1'-biphenyl azide (PubChem CID 18790861) has the molecular formula C12H10N3-
and a molecular weight of 196.23 g/mol. Its IUPAC name is 1,1'-biphenyl azide.
Molecular Properties
| Compound Name | 1,1'-biphenyl azide |
| PubChem CID | 18790861 |
| Molecular Formula | C12H10N3- |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 1,1'-biphenyl azide |
| SMILES | [N-]=[N+]=[N-].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.N3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;/q;-1 |
| InChIKey | HSJGPNDLNFCSRG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl azide?
The IUPAC name of 1,1'-biphenyl azide (CID 18790861) is 1,1'-biphenyl azide.
What is the SMILES notation for 1,1'-biphenyl azide?
The canonical SMILES for 1,1'-biphenyl azide is [N-]=[N+]=[N-].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl azide?
The InChIKey is HSJGPNDLNFCSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.N3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;/q;-1.
What are the key properties of 1,1'-biphenyl azide?
1,1'-biphenyl azide has a molecular weight of 196.23 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl azide is sourced from PubChem (CID 18790861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).