C17H16O6S — CID 18791050
2-(8-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carbonyl)cyclohexane-1,3-dione (PubChem CID 18791050) has the molecular formula C17H16O6S and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-(8-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carbonyl)cyclohexane-1,3-dione.
| Compound Name | 2-(8-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carbonyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 18791050 |
| Molecular Formula | C17H16O6S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-(8-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carbonyl)cyclohexane-1,3-dione |
| SMILES | Cc1c(C(=O)C2C(=O)CCCC2=O)ccc2c1S(=O)(=O)CCC2=O |
| InChI | InChI=1S/C17H16O6S/c1-9-10(16(21)15-13(19)3-2-4-14(15)20)5-6-11-12(18)7-8-24(22,23)17(9)11/h5-6,15H,2-4,7-8H2,1H3 |
| InChIKey | PCJZMXOHGIAGLV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|