About 1-ethoxybutan-2-ol
1-ethoxybutan-2-ol (PubChem CID 18791709) has the molecular formula C6H14O2
and a molecular weight of 118.18 g/mol. Its IUPAC name is 1-ethoxybutan-2-ol.
Molecular Properties
| Compound Name | 1-ethoxybutan-2-ol |
| PubChem CID | 18791709 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | 1-ethoxybutan-2-ol |
| SMILES | CCOCC(O)CC |
| InChI | InChI=1S/C6H14O2/c1-3-6(7)5-8-4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | JQPQGHSESNJJBC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxybutan-2-ol?
The IUPAC name of 1-ethoxybutan-2-ol (CID 18791709) is 1-ethoxybutan-2-ol.
What is the SMILES notation for 1-ethoxybutan-2-ol?
The canonical SMILES for 1-ethoxybutan-2-ol is CCOCC(O)CC.
What is the InChIKey of 1-ethoxybutan-2-ol?
The InChIKey is JQPQGHSESNJJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2/c1-3-6(7)5-8-4-2/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-ethoxybutan-2-ol?
1-ethoxybutan-2-ol has a molecular weight of 118.18 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxybutan-2-ol is sourced from PubChem (CID 18791709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).