C14H19NO — CID 18791720
4-benzyl-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 18791720) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-benzyl-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-benzyl-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 18791720 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-benzyl-5-(methoxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | COCC1=C(Cc2ccccc2)CCNC1 |
| InChI | InChI=1S/C14H19NO/c1-16-11-14-10-15-8-7-13(14)9-12-5-3-2-4-6-12/h2-6,15H,7-11H2,1H3 |
| InChIKey | BXAGJEXLYBCMNN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|