C29H33N5O5 — CID 18791733
3-[3-[4-benzyl-5-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole;oxalic acid (PubChem CID 18791733) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is 3-[3-[4-benzyl-5-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole;oxalic acid.
| Compound Name | 3-[3-[4-benzyl-5-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole;oxalic acid |
|---|---|
| PubChem CID | 18791733 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 3-[3-[4-benzyl-5-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propyl]-5-(1,2,4-triazol-4-yl)-1H-indole;oxalic acid |
| SMILES | COCC1=C(Cc2ccccc2)CCN(CCCc2c[nH]c3ccc(-n4cnnc4)cc23)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H31N5O.C2H2O4/c1-33-18-24-17-31(13-11-22(24)14-21-6-3-2-4-7-21)12-5-8-23-16-28-27-10-9-25(15-26(23)27)32-19-29-30-20-32;3-1(4)2(5)6/h2-4,6-7,9-10,15-16,19-20,28H,5,8,11-14,17-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ALXVWHHCLIXDTH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|