C15H15ClO3S — CID 18791826
2-(3,4,5-trimethylphenoxy)benzenesulfonyl chloride (PubChem CID 18791826) has the molecular formula C15H15ClO3S and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-(3,4,5-trimethylphenoxy)benzenesulfonyl chloride.
| Compound Name | 2-(3,4,5-trimethylphenoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 18791826 |
| Molecular Formula | C15H15ClO3S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(3,4,5-trimethylphenoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(Oc2ccccc2S(=O)(=O)Cl)cc(C)c1C |
| InChI | InChI=1S/C15H15ClO3S/c1-10-8-13(9-11(2)12(10)3)19-14-6-4-5-7-15(14)20(16,17)18/h4-9H,1-3H3 |
| InChIKey | VUAYZCYYXNAMTE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |