C30H24O2S2 — CID 18791830
1,2-diethyl-4,5-bis(phenylsulfanyl)anthracene-9,10-dione (PubChem CID 18791830) has the molecular formula C30H24O2S2 and a molecular weight of 480.65 g/mol. Its IUPAC name is 1,2-diethyl-4,5-bis(phenylsulfanyl)anthracene-9,10-dione.
| Compound Name | 1,2-diethyl-4,5-bis(phenylsulfanyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 18791830 |
| Molecular Formula | C30H24O2S2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1,2-diethyl-4,5-bis(phenylsulfanyl)anthracene-9,10-dione |
| SMILES | CCc1cc(Sc2ccccc2)c2c(c1CC)C(=O)c1cccc(Sc3ccccc3)c1C2=O |
| InChI | InChI=1S/C30H24O2S2/c1-3-19-18-25(34-21-14-9-6-10-15-21)28-27(22(19)4-2)29(31)23-16-11-17-24(26(23)30(28)32)33-20-12-7-5-8-13-20/h5-18H,3-4H2,1-2H3 |
| InChIKey | WVBFUOFVBVLQNV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|