C18H21F18N — CID 18792137
4,4,5,5,6,6,7,7,8-nonafluoro-N-(4,4,5,5,6,6,7,7,8-nonafluorononyl)nonan-1-amine (PubChem CID 18792137) has the molecular formula C18H21F18N and a molecular weight of 593.34 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8-nonafluoro-N-(4,4,5,5,6,6,7,7,8-nonafluorononyl)nonan-1-amine.
| Compound Name | 4,4,5,5,6,6,7,7,8-nonafluoro-N-(4,4,5,5,6,6,7,7,8-nonafluorononyl)nonan-1-amine |
|---|---|
| PubChem CID | 18792137 |
| Molecular Formula | C18H21F18N |
| Molecular Weight | 593.34 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8-nonafluoro-N-(4,4,5,5,6,6,7,7,8-nonafluorononyl)nonan-1-amine |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCNCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C18H21F18N/c1-9(19)13(25,26)17(33,34)15(29,30)11(21,22)5-3-7-37-8-4-6-12(23,24)16(31,32)18(35,36)14(27,28)10(2)20/h9-10,37H,3-8H2,1-2H3 |
| InChIKey | BISYUDPXAMMKNY-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.34 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|