C15H15F18N — CID 18792139
1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoropentadecan-8-amine (PubChem CID 18792139) has the molecular formula C15H15F18N and a molecular weight of 551.26 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoropentadecan-8-amine.
| Compound Name | 1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoropentadecan-8-amine |
|---|---|
| PubChem CID | 18792139 |
| Molecular Formula | C15H15F18N |
| Molecular Weight | 551.26 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoropentadecan-8-amine |
| SMILES | NC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F18N/c16-8(17,10(20,21)12(24,25)14(28,29)30)5-1-3-7(34)4-2-6-9(18,19)11(22,23)13(26,27)15(31,32)33/h7H,1-6,34H2 |
| InChIKey | JZORQSQUPPAOGL-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.26 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|