About 3-(ethylamino)butanamide
3-(ethylamino)butanamide (PubChem CID 18792210) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3-(ethylamino)butanamide.
Molecular Properties
| Compound Name | 3-(ethylamino)butanamide |
| PubChem CID | 18792210 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 3-(ethylamino)butanamide |
| SMILES | CCNC(C)CC(N)=O |
| InChI | InChI=1S/C6H14N2O/c1-3-8-5(2)4-6(7)9/h5,8H,3-4H2,1-2H3,(H2,7,9) |
| InChIKey | NYVCMIRRHXJENH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(ethylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)butanamide?
The IUPAC name of 3-(ethylamino)butanamide (CID 18792210) is 3-(ethylamino)butanamide.
What is the SMILES notation for 3-(ethylamino)butanamide?
The canonical SMILES for 3-(ethylamino)butanamide is CCNC(C)CC(N)=O.
What is the InChIKey of 3-(ethylamino)butanamide?
The InChIKey is NYVCMIRRHXJENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-3-8-5(2)4-6(7)9/h5,8H,3-4H2,1-2H3,(H2,7,9).
What are the key properties of 3-(ethylamino)butanamide?
3-(ethylamino)butanamide has a molecular weight of 130.19 g/mol, XLogP of -0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)butanamide is sourced from PubChem (CID 18792210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).