About 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine
2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine (PubChem CID 18792351) has the molecular formula C26H22N4Si
and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine |
| PubChem CID | 18792351 |
| Molecular Formula | C26H22N4Si |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine |
| SMILES | C[Si]1(C)C(c2ncccn2)=C(c2ccccc2)C(c2ccccc2)=C1c1ncccn1 |
| InChI | InChI=1S/C26H22N4Si/c1-31(2)23(25-27-15-9-16-28-25)21(19-11-5-3-6-12-19)22(20-13-7-4-8-14-20)24(31)26-29-17-10-18-30-26/h3-18H,1-2H3 |
| InChIKey | KVYGZJWAADHDOB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine?
The IUPAC name of 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine (CID 18792351) is 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine.
What is the SMILES notation for 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine?
The canonical SMILES for 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine is C[Si]1(C)C(c2ncccn2)=C(c2ccccc2)C(c2ccccc2)=C1c1ncccn1.
What is the InChIKey of 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine?
The InChIKey is KVYGZJWAADHDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N4Si/c1-31(2)23(25-27-15-9-16-28-25)21(19-11-5-3-6-12-19)22(20-13-7-4-8-14-20)24(31)26-29-17-10-18-30-26/h3-18H,1-2H3.
What are the key properties of 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine?
2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine has a molecular weight of 418.58 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dimethyl-3,4-diphenyl-5-pyrimidin-2-ylsilol-2-yl)pyrimidine is sourced from PubChem (CID 18792351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).