C36H24F8N2Si — CID 18792486
4-[1-tert-butyl-1,3,4-triphenyl-5-(2,3,5,6-tetrafluoro-4-pyridinyl)silol-2-yl]-2,3,5,6-tetrafluoropyridine (PubChem CID 18792486) has the molecular formula C36H24F8N2Si and a molecular weight of 664.67 g/mol. Its IUPAC name is 4-[1-tert-butyl-1,3,4-triphenyl-5-(2,3,5,6-tetrafluoro-4-pyridinyl)silol-2-yl]-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-[1-tert-butyl-1,3,4-triphenyl-5-(2,3,5,6-tetrafluoro-4-pyridinyl)silol-2-yl]-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 18792486 |
| Molecular Formula | C36H24F8N2Si |
| Molecular Weight | 664.67 g/mol |
| Exact Mass | 664.16 |
| IUPAC Name | 4-[1-tert-butyl-1,3,4-triphenyl-5-(2,3,5,6-tetrafluoro-4-pyridinyl)silol-2-yl]-2,3,5,6-tetrafluoropyridine |
| SMILES | CC(C)(C)[Si]1(c2ccccc2)C(c2c(F)c(F)nc(F)c2F)=C(c2ccccc2)C(c2ccccc2)=C1c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C36H24F8N2Si/c1-36(2,3)47(21-17-11-6-12-18-21)30(24-26(37)32(41)45-33(42)27(24)38)22(19-13-7-4-8-14-19)23(20-15-9-5-10-16-20)31(47)25-28(39)34(43)46-35(44)29(25)40/h4-18H,1-3H3 |
| InChIKey | JGMGTTSBEMRMRK-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.67 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|