About 2-(aminodiazenyl)aniline
2-(aminodiazenyl)aniline (PubChem CID 18792571) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 2-(aminodiazenyl)aniline.
Molecular Properties
| Compound Name | 2-(aminodiazenyl)aniline |
| PubChem CID | 18792571 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 2-(aminodiazenyl)aniline |
| SMILES | N/N=N/c1ccccc1N |
| InChI | InChI=1S/C6H8N4/c7-5-3-1-2-4-6(5)9-10-8/h1-4H,7H2,(H2,8,9) |
| InChIKey | CUXFGNCHPRLLLP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminodiazenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminodiazenyl)aniline?
The IUPAC name of 2-(aminodiazenyl)aniline (CID 18792571) is 2-(aminodiazenyl)aniline.
What is the SMILES notation for 2-(aminodiazenyl)aniline?
The canonical SMILES for 2-(aminodiazenyl)aniline is N/N=N/c1ccccc1N.
What is the InChIKey of 2-(aminodiazenyl)aniline?
The InChIKey is CUXFGNCHPRLLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-5-3-1-2-4-6(5)9-10-8/h1-4H,7H2,(H2,8,9).
What are the key properties of 2-(aminodiazenyl)aniline?
2-(aminodiazenyl)aniline has a molecular weight of 136.16 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminodiazenyl)aniline is sourced from PubChem (CID 18792571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).