About N-methylmethanamine;4-phenyldiazenylaniline
N-methylmethanamine;4-phenyldiazenylaniline (PubChem CID 18792572) has the molecular formula C14H18N4
and a molecular weight of 242.33 g/mol. Its IUPAC name is N-methylmethanamine;4-phenyldiazenylaniline.
Molecular Properties
| Compound Name | N-methylmethanamine;4-phenyldiazenylaniline |
| PubChem CID | 18792572 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-methylmethanamine;4-phenyldiazenylaniline |
| SMILES | CNC.Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N3.C2H7N/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11;1-3-2/h1-9H,13H2;3H,1-2H3/b15-14+; |
| InChIKey | ZRBFOROHMYZSCN-WPDLWGESSA-N |
| XLogP | 3.52 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;4-phenyldiazenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;4-phenyldiazenylaniline?
The IUPAC name of N-methylmethanamine;4-phenyldiazenylaniline (CID 18792572) is N-methylmethanamine;4-phenyldiazenylaniline.
What is the SMILES notation for N-methylmethanamine;4-phenyldiazenylaniline?
The canonical SMILES for N-methylmethanamine;4-phenyldiazenylaniline is CNC.Nc1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of N-methylmethanamine;4-phenyldiazenylaniline?
The InChIKey is ZRBFOROHMYZSCN-WPDLWGESSA-N. The full InChI is InChI=1S/C12H11N3.C2H7N/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11;1-3-2/h1-9H,13H2;3H,1-2H3/b15-14+;.
What are the key properties of N-methylmethanamine;4-phenyldiazenylaniline?
N-methylmethanamine;4-phenyldiazenylaniline has a molecular weight of 242.33 g/mol, XLogP of 3.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;4-phenyldiazenylaniline is sourced from PubChem (CID 18792572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).