C8H11F3N2O3S — CID 18792629
N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate (PubChem CID 18792629) has the molecular formula C8H11F3N2O3S and a molecular weight of 272.25 g/mol. Its IUPAC name is N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate.
| Compound Name | N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18792629 |
| Molecular Formula | C8H11F3N2O3S |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
| SMILES | CN(C)c1cc[nH+]cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C7H10N2.CHF3O3S/c1-9(2)7-3-5-8-6-4-7;2-1(3,4)8(5,6)7/h3-6H,1-2H3;(H,5,6,7) |
| InChIKey | RGGFMFZQWTZKDV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 74.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|