About butane;diethyl 2-but-3-enylpropanedioate
butane;diethyl 2-but-3-enylpropanedioate (PubChem CID 18793367) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is butane;diethyl 2-but-3-enylpropanedioate.
Molecular Properties
| Compound Name | butane;diethyl 2-but-3-enylpropanedioate |
| PubChem CID | 18793367 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | butane;diethyl 2-but-3-enylpropanedioate |
| SMILES | C=CCCC(C(=O)OCC)C(=O)OCC.CCCC |
| InChI | InChI=1S/C11H18O4.C4H10/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3;1-3-4-2/h4,9H,1,5-8H2,2-3H3;3-4H2,1-2H3 |
| InChIKey | AQWJMTIMYQABOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;diethyl 2-but-3-enylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;diethyl 2-but-3-enylpropanedioate?
The IUPAC name of butane;diethyl 2-but-3-enylpropanedioate (CID 18793367) is butane;diethyl 2-but-3-enylpropanedioate.
What is the SMILES notation for butane;diethyl 2-but-3-enylpropanedioate?
The canonical SMILES for butane;diethyl 2-but-3-enylpropanedioate is C=CCCC(C(=O)OCC)C(=O)OCC.CCCC.
What is the InChIKey of butane;diethyl 2-but-3-enylpropanedioate?
The InChIKey is AQWJMTIMYQABOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4.C4H10/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3;1-3-4-2/h4,9H,1,5-8H2,2-3H3;3-4H2,1-2H3.
What are the key properties of butane;diethyl 2-but-3-enylpropanedioate?
butane;diethyl 2-but-3-enylpropanedioate has a molecular weight of 272.38 g/mol, XLogP of 3.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;diethyl 2-but-3-enylpropanedioate is sourced from PubChem (CID 18793367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).