About 4-pyridin-4-yloxyphenol
4-pyridin-4-yloxyphenol (PubChem CID 18794474) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-pyridin-4-yloxyphenol.
Molecular Properties
| Compound Name | 4-pyridin-4-yloxyphenol |
| PubChem CID | 18794474 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-pyridin-4-yloxyphenol |
| SMILES | Oc1ccc(Oc2ccncc2)cc1 |
| InChI | InChI=1S/C11H9NO2/c13-9-1-3-10(4-2-9)14-11-5-7-12-8-6-11/h1-8,13H |
| InChIKey | JPVVRFKXDFIJLM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridin-4-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-yloxyphenol?
The IUPAC name of 4-pyridin-4-yloxyphenol (CID 18794474) is 4-pyridin-4-yloxyphenol.
What is the SMILES notation for 4-pyridin-4-yloxyphenol?
The canonical SMILES for 4-pyridin-4-yloxyphenol is Oc1ccc(Oc2ccncc2)cc1.
What is the InChIKey of 4-pyridin-4-yloxyphenol?
The InChIKey is JPVVRFKXDFIJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-9-1-3-10(4-2-9)14-11-5-7-12-8-6-11/h1-8,13H.
What are the key properties of 4-pyridin-4-yloxyphenol?
4-pyridin-4-yloxyphenol has a molecular weight of 187.20 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-yloxyphenol is sourced from PubChem (CID 18794474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).