C26H27F6NO2 — CID 18794630
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-hexyl-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxamide (PubChem CID 18794630) has the molecular formula C26H27F6NO2 and a molecular weight of 499.50 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-hexyl-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-hexyl-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18794630 |
| Molecular Formula | C26H27F6NO2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-hexyl-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxamide |
| SMILES | CCCCCCC1CCc2cc(C(=O)NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2C1=O |
| InChI | InChI=1S/C26H27F6NO2/c1-2-3-4-5-6-17-7-8-18-13-19(9-10-22(18)23(17)34)24(35)33-15-16-11-20(25(27,28)29)14-21(12-16)26(30,31)32/h9-14,17H,2-8,15H2,1H3,(H,33,35) |
| InChIKey | GVMBTSCOQCDVKB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|