About 2-(triazol-1-yl)pyridine
2-(triazol-1-yl)pyridine (PubChem CID 18794864) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-(triazol-1-yl)pyridine.
Molecular Properties
| Compound Name | 2-(triazol-1-yl)pyridine |
| PubChem CID | 18794864 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-(triazol-1-yl)pyridine |
| SMILES | c1ccc(-n2ccnn2)nc1 |
| InChI | InChI=1S/C7H6N4/c1-2-4-8-7(3-1)11-6-5-9-10-11/h1-6H |
| InChIKey | CPUDLFSMVVGOOP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(triazol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-1-yl)pyridine?
The IUPAC name of 2-(triazol-1-yl)pyridine (CID 18794864) is 2-(triazol-1-yl)pyridine.
What is the SMILES notation for 2-(triazol-1-yl)pyridine?
The canonical SMILES for 2-(triazol-1-yl)pyridine is c1ccc(-n2ccnn2)nc1.
What is the InChIKey of 2-(triazol-1-yl)pyridine?
The InChIKey is CPUDLFSMVVGOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-2-4-8-7(3-1)11-6-5-9-10-11/h1-6H.
What are the key properties of 2-(triazol-1-yl)pyridine?
2-(triazol-1-yl)pyridine has a molecular weight of 146.15 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-1-yl)pyridine is sourced from PubChem (CID 18794864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).