C20H21F17O2 — CID 18794977
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hexyldecyl) 2-methylprop-2-enoate (PubChem CID 18794977) has the molecular formula C20H21F17O2 and a molecular weight of 616.35 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hexyldecyl) 2-methylprop-2-enoate.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hexyldecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18794977 |
| Molecular Formula | C20H21F17O2 |
| Molecular Weight | 616.35 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hexyldecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCCCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H21F17O2/c1-4-5-6-7-8-11(9-39-12(38)10(2)3)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h11H,2,4-9H2,1,3H3 |
| InChIKey | JHRUXVULWNGZDN-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.35 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|