About 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane
2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 18794994) has the molecular formula C13H26O5
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 18794994 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC(CO)CC(C)CO |
| InChI | InChI=1S/C7H16O2.C6H10O3/c1-6(4-8)3-7(2)5-9;1(5-3-8-5)7-2-6-4-9-6/h6-9H,3-5H2,1-2H3;5-6H,1-4H2 |
| InChIKey | GMDHAUYPVWKYKL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 18794994) is 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CC(CO)CC(C)CO.
What is the InChIKey of 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is GMDHAUYPVWKYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C6H10O3/c1-6(4-8)3-7(2)5-9;1(5-3-8-5)7-2-6-4-9-6/h6-9H,3-5H2,1-2H3;5-6H,1-4H2.
What are the key properties of 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 262.35 g/mol, XLogP of 0.43, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentane-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 18794994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).