C14H14F10 — CID 18795057
1,3,4,6-tetramethyl-3,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,4-diene (PubChem CID 18795057) has the molecular formula C14H14F10 and a molecular weight of 372.25 g/mol. Its IUPAC name is 1,3,4,6-tetramethyl-3,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,4-diene.
| Compound Name | 1,3,4,6-tetramethyl-3,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 18795057 |
| Molecular Formula | C14H14F10 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1,3,4,6-tetramethyl-3,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,4-diene |
| SMILES | CC1=CC(C)(C(F)(F)C(F)(F)F)C(C)=CC1(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F10/c1-7-5-10(4,12(17,18)14(22,23)24)8(2)6-9(7,3)11(15,16)13(19,20)21/h5-6H,1-4H3 |
| InChIKey | TYUSZWWZJIUPJI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|