C8H12Cl3FO2 — CID 18795123
4,6,6-trichloro-6-fluoro-3,3-dimethylhexanoic acid (PubChem CID 18795123) has the molecular formula C8H12Cl3FO2 and a molecular weight of 265.54 g/mol. Its IUPAC name is 4,6,6-trichloro-6-fluoro-3,3-dimethylhexanoic acid.
| Compound Name | 4,6,6-trichloro-6-fluoro-3,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 18795123 |
| Molecular Formula | C8H12Cl3FO2 |
| Molecular Weight | 265.54 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 4,6,6-trichloro-6-fluoro-3,3-dimethylhexanoic acid |
| SMILES | CC(C)(CC(=O)O)C(Cl)CC(F)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3FO2/c1-7(2,4-6(13)14)5(9)3-8(10,11)12/h5H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | QSQSVURBJLVSLR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|