About ethane-1,2-diol;propan-2-one
ethane-1,2-diol;propan-2-one (PubChem CID 18795199) has the molecular formula C5H12O3
and a molecular weight of 120.15 g/mol. Its IUPAC name is ethane-1,2-diol;propan-2-one.
Molecular Properties
| Compound Name | ethane-1,2-diol;propan-2-one |
| PubChem CID | 18795199 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | ethane-1,2-diol;propan-2-one |
| SMILES | CC(C)=O.OCCO |
| InChI | InChI=1S/C3H6O.C2H6O2/c1-3(2)4;3-1-2-4/h1-2H3;3-4H,1-2H2 |
| InChIKey | ACOTYZCHRLPBKW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane-1,2-diol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;propan-2-one?
The IUPAC name of ethane-1,2-diol;propan-2-one (CID 18795199) is ethane-1,2-diol;propan-2-one.
What is the SMILES notation for ethane-1,2-diol;propan-2-one?
The canonical SMILES for ethane-1,2-diol;propan-2-one is CC(C)=O.OCCO.
What is the InChIKey of ethane-1,2-diol;propan-2-one?
The InChIKey is ACOTYZCHRLPBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H6O2/c1-3(2)4;3-1-2-4/h1-2H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;propan-2-one?
ethane-1,2-diol;propan-2-one has a molecular weight of 120.15 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;propan-2-one is sourced from PubChem (CID 18795199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).