C16H22 — CID 18795210
(4E)-hexa-1,4-diene;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 18795210) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (4E)-hexa-1,4-diene;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (4E)-hexa-1,4-diene;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 18795210 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (4E)-hexa-1,4-diene;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=CC/C=C/C |
| InChI | InChI=1S/C10H12.C6H10/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-3-5-6-4-2/h1-2,4-5,7-10H,3,6H2;3-4,6H,1,5H2,2H3/b;6-4+ |
| InChIKey | GMELSSYNVBYUIL-DVXCEAISSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|