About (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium
(2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium (PubChem CID 18795391) has the molecular formula C34H43BNO3+
and a molecular weight of 524.53 g/mol. Its IUPAC name is (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium.
Molecular Properties
| Compound Name | (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium |
| PubChem CID | 18795391 |
| Molecular Formula | C34H43BNO3+ |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.Cc1cc(C)c(OB(Oc2ccccc2-c2ccccc2)Oc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C30H31BO3.C4H12N/c1-20-16-22(3)29(23(4)17-20)33-31(34-30-24(5)18-21(2)19-25(30)6)32-28-15-11-10-14-27(28)26-12-8-7-9-13-26;1-5(2,3)4/h7-19H,1-6H3;1-4H3/q;+1 |
| InChIKey | XPGIAYLMCJIIBL-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium?
The IUPAC name of (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium (CID 18795391) is (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium.
What is the SMILES notation for (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium?
The canonical SMILES for (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium is C[N+](C)(C)C.Cc1cc(C)c(OB(Oc2ccccc2-c2ccccc2)Oc2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium?
The InChIKey is XPGIAYLMCJIIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31BO3.C4H12N/c1-20-16-22(3)29(23(4)17-20)33-31(34-30-24(5)18-21(2)19-25(30)6)32-28-15-11-10-14-27(28)26-12-8-7-9-13-26;1-5(2,3)4/h7-19H,1-6H3;1-4H3/q;+1.
What are the key properties of (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium?
(2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium has a molecular weight of 524.53 g/mol, XLogP of 8.05, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl) bis(2,4,6-trimethylphenyl) borate;tetramethylazanium is sourced from PubChem (CID 18795391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).