About 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one
3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (PubChem CID 18795446) has the molecular formula C19H25NO3
and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| PubChem CID | 18795446 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(=O)CC(C)C)CO1 |
| InChI | InChI=1S/C19H25NO3/c1-13(2)11-16(21)19(4,5)20-12-23-14(3)17(18(20)22)15-9-7-6-8-10-15/h6-10,13H,11-12H2,1-5H3 |
| InChIKey | DMISVDTVWDIPOZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The IUPAC name of 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (CID 18795446) is 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one is CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(=O)CC(C)C)CO1.
What is the InChIKey of 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The InChIKey is DMISVDTVWDIPOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO3/c1-13(2)11-16(21)19(4,5)20-12-23-14(3)17(18(20)22)15-9-7-6-8-10-15/h6-10,13H,11-12H2,1-5H3.
What are the key properties of 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one has a molecular weight of 315.41 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethyl-3-oxohexan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 18795446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).