About 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one
3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (PubChem CID 18795461) has the molecular formula C21H22ClNO3
and a molecular weight of 371.86 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| PubChem CID | 18795461 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(O)c2cccc(Cl)c2)CO1 |
| InChI | InChI=1S/C21H22ClNO3/c1-14-18(15-8-5-4-6-9-15)20(25)23(13-26-14)21(2,3)19(24)16-10-7-11-17(22)12-16/h4-12,19,24H,13H2,1-3H3 |
| InChIKey | OKFNQYZQGDNUAR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The IUPAC name of 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one (CID 18795461) is 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one is CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(O)c2cccc(Cl)c2)CO1.
What is the InChIKey of 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
The InChIKey is OKFNQYZQGDNUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO3/c1-14-18(15-8-5-4-6-9-15)20(25)23(13-26-14)21(2,3)19(24)16-10-7-11-17(22)12-16/h4-12,19,24H,13H2,1-3H3.
What are the key properties of 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one?
3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one has a molecular weight of 371.86 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-chlorophenyl)-1-hydroxy-2-methylpropan-2-yl]-6-methyl-5-phenyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 18795461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).