C19H28O6 — CID 18795798
9-[2-(3-carboxypropoxy)phenoxy]nonanoic acid (PubChem CID 18795798) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is 9-[2-(3-carboxypropoxy)phenoxy]nonanoic acid.
| Compound Name | 9-[2-(3-carboxypropoxy)phenoxy]nonanoic acid |
|---|---|
| PubChem CID | 18795798 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 9-[2-(3-carboxypropoxy)phenoxy]nonanoic acid |
| SMILES | O=C(O)CCCCCCCCOc1ccccc1OCCCC(=O)O |
| InChI | InChI=1S/C19H28O6/c20-18(21)12-5-3-1-2-4-8-14-24-16-10-6-7-11-17(16)25-15-9-13-19(22)23/h6-7,10-11H,1-5,8-9,12-15H2,(H,20,21)(H,22,23) |
| InChIKey | LEINAVWJPMEEOJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|