C19H30NO7P — CID 18795834
7-[2-[(4-methyl-5-phosphonopentanoyl)amino]phenoxy]heptanoic acid (PubChem CID 18795834) has the molecular formula C19H30NO7P and a molecular weight of 415.42 g/mol. Its IUPAC name is 7-[2-[(4-methyl-5-phosphonopentanoyl)amino]phenoxy]heptanoic acid.
| Compound Name | 7-[2-[(4-methyl-5-phosphonopentanoyl)amino]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 18795834 |
| Molecular Formula | C19H30NO7P |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 7-[2-[(4-methyl-5-phosphonopentanoyl)amino]phenoxy]heptanoic acid |
| SMILES | CC(CCC(=O)Nc1ccccc1OCCCCCCC(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C19H30NO7P/c1-15(14-28(24,25)26)11-12-18(21)20-16-8-5-6-9-17(16)27-13-7-3-2-4-10-19(22)23/h5-6,8-9,15H,2-4,7,10-14H2,1H3,(H,20,21)(H,22,23)(H2,24,25,26) |
| InChIKey | KDDSDLWYYJUDAL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|