About 1H-indole;dihydrochloride
1H-indole;dihydrochloride (PubChem CID 18796541) has the molecular formula C8H9Cl2N
and a molecular weight of 190.07 g/mol. Its IUPAC name is 1H-indole;dihydrochloride.
Molecular Properties
| Compound Name | 1H-indole;dihydrochloride |
| PubChem CID | 18796541 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 1H-indole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.2ClH/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6,9H;2*1H |
| InChIKey | IPONLHAIQBCUCY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;dihydrochloride?
The IUPAC name of 1H-indole;dihydrochloride (CID 18796541) is 1H-indole;dihydrochloride.
What is the SMILES notation for 1H-indole;dihydrochloride?
The canonical SMILES for 1H-indole;dihydrochloride is Cl.Cl.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;dihydrochloride?
The InChIKey is IPONLHAIQBCUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.2ClH/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6,9H;2*1H.
What are the key properties of 1H-indole;dihydrochloride?
1H-indole;dihydrochloride has a molecular weight of 190.07 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;dihydrochloride is sourced from PubChem (CID 18796541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).