About 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride
1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride (PubChem CID 18796586) has the molecular formula C15H20Cl2N6
and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride.
Molecular Properties
| Compound Name | 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride |
| PubChem CID | 18796586 |
| Molecular Formula | C15H20Cl2N6 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride |
| SMILES | CN1CCC(n2ncc3ccc(-n4cnnc4)cc32)CC1.Cl.Cl |
| InChI | InChI=1S/C15H18N6.2ClH/c1-19-6-4-13(5-7-19)21-15-8-14(20-10-16-17-11-20)3-2-12(15)9-18-21;;/h2-3,8-11,13H,4-7H2,1H3;2*1H |
| InChIKey | IQOULBRZJHJSLO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride?
The IUPAC name of 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride (CID 18796586) is 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride.
What is the SMILES notation for 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride?
The canonical SMILES for 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride is CN1CCC(n2ncc3ccc(-n4cnnc4)cc32)CC1.Cl.Cl.
What is the InChIKey of 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride?
The InChIKey is IQOULBRZJHJSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6.2ClH/c1-19-6-4-13(5-7-19)21-15-8-14(20-10-16-17-11-20)3-2-12(15)9-18-21;;/h2-3,8-11,13H,4-7H2,1H3;2*1H.
What are the key properties of 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride?
1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride has a molecular weight of 355.27 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylpiperidin-4-yl)-6-(1,2,4-triazol-4-yl)indazole;dihydrochloride is sourced from PubChem (CID 18796586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).