C21H25N3O6 — CID 18796640
6,7,8-trimethoxy-N-[(2,4,6-trimethoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 18796640) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 6,7,8-trimethoxy-N-[(2,4,6-trimethoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 6,7,8-trimethoxy-N-[(2,4,6-trimethoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 18796640 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 6,7,8-trimethoxy-N-[(2,4,6-trimethoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1cc(OC)c(CNc2ncnc3c(OC)c(OC)c(OC)cc23)c(OC)c1 |
| InChI | InChI=1S/C21H25N3O6/c1-25-12-7-15(26-2)14(16(8-12)27-3)10-22-21-13-9-17(28-4)19(29-5)20(30-6)18(13)23-11-24-21/h7-9,11H,10H2,1-6H3,(H,22,23,24) |
| InChIKey | ZOUOIRBVHPINKE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |