About ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate
ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate (PubChem CID 18796645) has the molecular formula C17H18Cl2N2O2
and a molecular weight of 353.25 g/mol. Its IUPAC name is ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate |
| PubChem CID | 18796645 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(c2nc(Cl)c3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-2-23-17(22)11-5-3-10(4-6-11)16-20-14-8-7-12(18)9-13(14)15(19)21-16/h7-11H,2-6H2,1H3 |
| InChIKey | YBWFLTPGCKIUQV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate (CID 18796645) is ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate is CCOC(=O)C1CCC(c2nc(Cl)c3cc(Cl)ccc3n2)CC1.
What is the InChIKey of ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate?
The InChIKey is YBWFLTPGCKIUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O2/c1-2-23-17(22)11-5-3-10(4-6-11)16-20-14-8-7-12(18)9-13(14)15(19)21-16/h7-11H,2-6H2,1H3.
What are the key properties of ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate?
ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate has a molecular weight of 353.25 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4,6-dichloroquinazolin-2-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 18796645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).