C28H28F3N3O5S — CID 18797031
[1-[2-[[4-(4-carbamoylphenyl)benzoyl]amino]butyl]-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate (PubChem CID 18797031) has the molecular formula C28H28F3N3O5S and a molecular weight of 575.61 g/mol. Its IUPAC name is [1-[2-[[4-(4-carbamoylphenyl)benzoyl]amino]butyl]-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [1-[2-[[4-(4-carbamoylphenyl)benzoyl]amino]butyl]-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18797031 |
| Molecular Formula | C28H28F3N3O5S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | [1-[2-[[4-(4-carbamoylphenyl)benzoyl]amino]butyl]-1,2,3,4-tetrahydroisoquinolin-7-yl] trifluoromethanesulfonate |
| SMILES | CCC(CC1NCCc2ccc(OS(=O)(=O)C(F)(F)F)cc21)NC(=O)c1ccc(-c2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C28H28F3N3O5S/c1-2-22(34-27(36)21-9-5-18(6-10-21)17-3-7-20(8-4-17)26(32)35)15-25-24-16-23(12-11-19(24)13-14-33-25)39-40(37,38)28(29,30)31/h3-12,16,22,25,33H,2,13-15H2,1H3,(H2,32,35)(H,34,36) |
| InChIKey | DTCOMBYFPDBRBZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|