About acetyloxyaluminum(2+);bis(propan-2-olate)
acetyloxyaluminum(2+);bis(propan-2-olate) (PubChem CID 18798494) has the molecular formula C8H17AlO4
and a molecular weight of 204.20 g/mol. Its IUPAC name is acetyloxyaluminum(2+);bis(propan-2-olate).
Molecular Properties
| Compound Name | acetyloxyaluminum(2+);bis(propan-2-olate) |
| PubChem CID | 18798494 |
| Molecular Formula | C8H17AlO4 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | acetyloxyaluminum(2+);bis(propan-2-olate) |
| SMILES | CC(=O)O[Al+2].CC(C)[O-].CC(C)[O-] |
| InChI | InChI=1S/2C3H7O.C2H4O2.Al/c2*1-3(2)4;1-2(3)4;/h2*3H,1-2H3;1H3,(H,3,4);/q2*-1;;+3/p-1 |
| InChIKey | HJFUUQISSHZQRS-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetyloxyaluminum(2+);bis(propan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxyaluminum(2+);bis(propan-2-olate)?
The IUPAC name of acetyloxyaluminum(2+);bis(propan-2-olate) (CID 18798494) is acetyloxyaluminum(2+);bis(propan-2-olate).
What is the SMILES notation for acetyloxyaluminum(2+);bis(propan-2-olate)?
The canonical SMILES for acetyloxyaluminum(2+);bis(propan-2-olate) is CC(=O)O[Al+2].CC(C)[O-].CC(C)[O-].
What is the InChIKey of acetyloxyaluminum(2+);bis(propan-2-olate)?
The InChIKey is HJFUUQISSHZQRS-UHFFFAOYSA-M. The full InChI is InChI=1S/2C3H7O.C2H4O2.Al/c2*1-3(2)4;1-2(3)4;/h2*3H,1-2H3;1H3,(H,3,4);/q2*-1;;+3/p-1.
What are the key properties of acetyloxyaluminum(2+);bis(propan-2-olate)?
acetyloxyaluminum(2+);bis(propan-2-olate) has a molecular weight of 204.20 g/mol, XLogP of -0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxyaluminum(2+);bis(propan-2-olate) is sourced from PubChem (CID 18798494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).