C6H11F5O3Si — CID 18798501
trimethoxy(1,2,2,3,3-pentafluoropropyl)silane (PubChem CID 18798501) has the molecular formula C6H11F5O3Si and a molecular weight of 254.23 g/mol. Its IUPAC name is trimethoxy(1,2,2,3,3-pentafluoropropyl)silane.
| Compound Name | trimethoxy(1,2,2,3,3-pentafluoropropyl)silane |
|---|---|
| PubChem CID | 18798501 |
| Molecular Formula | C6H11F5O3Si |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | trimethoxy(1,2,2,3,3-pentafluoropropyl)silane |
| SMILES | CO[Si](OC)(OC)C(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H11F5O3Si/c1-12-15(13-2,14-3)5(9)6(10,11)4(7)8/h4-5H,1-3H3 |
| InChIKey | NRYUHYZHZPNLIB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|