C8H2F16O — CID 18798504
2-(difluoromethyl)-1-[2-(difluoromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane (PubChem CID 18798504) has the molecular formula C8H2F16O and a molecular weight of 418.07 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-[2-(difluoromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane.
| Compound Name | 2-(difluoromethyl)-1-[2-(difluoromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 18798504 |
| Molecular Formula | C8H2F16O |
| Molecular Weight | 418.07 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-(difluoromethyl)-1-[2-(difluoromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane |
| SMILES | FC(F)C(F)(C(F)(F)F)C(F)(F)OC(F)(F)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16O/c9-1(10)3(13,5(15,16)17)7(21,22)25-8(23,24)4(14,2(11)12)6(18,19)20/h1-2H |
| InChIKey | GHTZSZMGMVPPAH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |