C11H23BrMg — CID 18798532
magnesium;2,2,3,5,5-pentamethylhexane;bromide (PubChem CID 18798532) has the molecular formula C11H23BrMg and a molecular weight of 259.51 g/mol. Its IUPAC name is magnesium;2,2,3,5,5-pentamethylhexane;bromide.
| Compound Name | magnesium;2,2,3,5,5-pentamethylhexane;bromide |
|---|---|
| PubChem CID | 18798532 |
| Molecular Formula | C11H23BrMg |
| Molecular Weight | 259.51 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | magnesium;2,2,3,5,5-pentamethylhexane;bromide |
| SMILES | C[C-](CC(C)(C)C)C(C)(C)C.[Br-].[Mg+2] |
| InChI | InChI=1S/C11H23.BrH.Mg/c1-9(11(5,6)7)8-10(2,3)4;;/h8H2,1-7H3;1H;/q-1;;+2/p-1 |
| InChIKey | DTMUKVAAPGSPTQ-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.51 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|