About [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate
[2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate (PubChem CID 18798624) has the molecular formula C20H22F2O6S
and a molecular weight of 428.45 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate |
| PubChem CID | 18798624 |
| Molecular Formula | C20H22F2O6S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)(COC(=O)C(C)C)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H22F2O6S/c1-13(2)19(23)27-11-20(24,17-9-6-15(21)10-18(17)22)12-28-29(25,26)16-7-4-14(3)5-8-16/h4-10,13,24H,11-12H2,1-3H3 |
| InChIKey | CPASYSBGZHCVLJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate?
The IUPAC name of [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate (CID 18798624) is [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate.
What is the SMILES notation for [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate?
The canonical SMILES for [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate is Cc1ccc(S(=O)(=O)OCC(O)(COC(=O)C(C)C)c2ccc(F)cc2F)cc1.
What is the InChIKey of [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate?
The InChIKey is CPASYSBGZHCVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2O6S/c1-13(2)19(23)27-11-20(24,17-9-6-15(21)10-18(17)22)12-28-29(25,26)16-7-4-14(3)5-8-16/h4-10,13,24H,11-12H2,1-3H3.
What are the key properties of [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate?
[2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate has a molecular weight of 428.45 g/mol, XLogP of 3.07, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluorophenyl)-2-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl] 2-methylpropanoate is sourced from PubChem (CID 18798624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).