About 4-methylpiperazine-1-sulfonyl chloride;hydrochloride
4-methylpiperazine-1-sulfonyl chloride;hydrochloride (PubChem CID 18798705) has the molecular formula C5H12Cl2N2O2S
and a molecular weight of 235.14 g/mol. Its IUPAC name is 4-methylpiperazine-1-sulfonyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 4-methylpiperazine-1-sulfonyl chloride;hydrochloride |
| PubChem CID | 18798705 |
| Molecular Formula | C5H12Cl2N2O2S |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 4-methylpiperazine-1-sulfonyl chloride;hydrochloride |
| SMILES | CN1CCN(S(=O)(=O)Cl)CC1.Cl |
| InChI | InChI=1S/C5H11ClN2O2S.ClH/c1-7-2-4-8(5-3-7)11(6,9)10;/h2-5H2,1H3;1H |
| InChIKey | AYGQXEFMLQQXOD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylpiperazine-1-sulfonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpiperazine-1-sulfonyl chloride;hydrochloride?
The IUPAC name of 4-methylpiperazine-1-sulfonyl chloride;hydrochloride (CID 18798705) is 4-methylpiperazine-1-sulfonyl chloride;hydrochloride.
What is the SMILES notation for 4-methylpiperazine-1-sulfonyl chloride;hydrochloride?
The canonical SMILES for 4-methylpiperazine-1-sulfonyl chloride;hydrochloride is CN1CCN(S(=O)(=O)Cl)CC1.Cl.
What is the InChIKey of 4-methylpiperazine-1-sulfonyl chloride;hydrochloride?
The InChIKey is AYGQXEFMLQQXOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClN2O2S.ClH/c1-7-2-4-8(5-3-7)11(6,9)10;/h2-5H2,1H3;1H.
What are the key properties of 4-methylpiperazine-1-sulfonyl chloride;hydrochloride?
4-methylpiperazine-1-sulfonyl chloride;hydrochloride has a molecular weight of 235.14 g/mol, XLogP of 0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpiperazine-1-sulfonyl chloride;hydrochloride is sourced from PubChem (CID 18798705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).