C7H6F10O — CID 18798723
1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-methylpentane (PubChem CID 18798723) has the molecular formula C7H6F10O and a molecular weight of 296.10 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-methylpentane.
| Compound Name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-methylpentane |
|---|---|
| PubChem CID | 18798723 |
| Molecular Formula | C7H6F10O |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-methylpentane |
| SMILES | COC(F)(C(C)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O/c1-3(8,6(12,13)14)5(11,18-2)4(9,10)7(15,16)17/h1-2H3 |
| InChIKey | PQTXETKBUNLVER-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|