C10H6F16O — CID 18798724
2-(difluoromethyl)-4-[3-(difluoromethyl)-2,2,3,4,4,4-hexafluorobutoxy]-1,1,1,2,3,3-hexafluorobutane (PubChem CID 18798724) has the molecular formula C10H6F16O and a molecular weight of 446.13 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-[3-(difluoromethyl)-2,2,3,4,4,4-hexafluorobutoxy]-1,1,1,2,3,3-hexafluorobutane.
| Compound Name | 2-(difluoromethyl)-4-[3-(difluoromethyl)-2,2,3,4,4,4-hexafluorobutoxy]-1,1,1,2,3,3-hexafluorobutane |
|---|---|
| PubChem CID | 18798724 |
| Molecular Formula | C10H6F16O |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 2-(difluoromethyl)-4-[3-(difluoromethyl)-2,2,3,4,4,4-hexafluorobutoxy]-1,1,1,2,3,3-hexafluorobutane |
| SMILES | FC(F)C(F)(C(F)(F)F)C(F)(F)COCC(F)(F)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F16O/c11-3(12)7(19,9(21,22)23)5(15,16)1-27-2-6(17,18)8(20,4(13)14)10(24,25)26/h3-4H,1-2H2 |
| InChIKey | PTFOAFOPCVHEMI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |