About 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride
3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride (PubChem CID 18799049) has the molecular formula C13H18Cl2N2O2S
and a molecular weight of 337.27 g/mol. Its IUPAC name is 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride.
Molecular Properties
| Compound Name | 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride |
| PubChem CID | 18799049 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(NCC(O)CO)c(-c2cccs2)c1 |
| InChI | InChI=1S/C13H16N2O2S.2ClH/c14-9-3-4-12(15-7-10(17)8-16)11(6-9)13-2-1-5-18-13;;/h1-6,10,15-17H,7-8,14H2;2*1H |
| InChIKey | WSJBEDCNBMUZCD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride?
The IUPAC name of 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride (CID 18799049) is 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride.
What is the SMILES notation for 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride?
The canonical SMILES for 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride is Cl.Cl.Nc1ccc(NCC(O)CO)c(-c2cccs2)c1.
What is the InChIKey of 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride?
The InChIKey is WSJBEDCNBMUZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S.2ClH/c14-9-3-4-12(15-7-10(17)8-16)11(6-9)13-2-1-5-18-13;;/h1-6,10,15-17H,7-8,14H2;2*1H.
What are the key properties of 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride?
3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride has a molecular weight of 337.27 g/mol, XLogP of 2.61, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-2-thiophen-2-ylanilino)propane-1,2-diol;dihydrochloride is sourced from PubChem (CID 18799049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).