C15H27O2- — CID 18799146
2,3-dibutylhept-2-enoate (PubChem CID 18799146) has the molecular formula C15H27O2- and a molecular weight of 239.38 g/mol. Its IUPAC name is 2,3-dibutylhept-2-enoate.
| Compound Name | 2,3-dibutylhept-2-enoate |
|---|---|
| PubChem CID | 18799146 |
| Molecular Formula | C15H27O2- |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2,3-dibutylhept-2-enoate |
| SMILES | CCCCC(CCCC)=C(CCCC)C(=O)[O-] |
| InChI | InChI=1S/C15H28O2/c1-4-7-10-13(11-8-5-2)14(15(16)17)12-9-6-3/h4-12H2,1-3H3,(H,16,17)/p-1 |
| InChIKey | ATSDGQHKCBJZCD-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|