About 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine
2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 18799673) has the molecular formula C20H15F3N4OS
and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 18799673 |
| Molecular Formula | C20H15F3N4OS |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CC(Sc1nc(N)cc(C(F)(F)F)n1)c1cc2c(-c3ccccc3)coc2cn1 |
| InChI | InChI=1S/C20H15F3N4OS/c1-11(29-19-26-17(20(21,22)23)8-18(24)27-19)15-7-13-14(10-28-16(13)9-25-15)12-5-3-2-4-6-12/h2-11H,1H3,(H2,24,26,27) |
| InChIKey | NXAPAIIDMQIAOP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine (CID 18799673) is 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine is CC(Sc1nc(N)cc(C(F)(F)F)n1)c1cc2c(-c3ccccc3)coc2cn1.
What is the InChIKey of 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is NXAPAIIDMQIAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N4OS/c1-11(29-19-26-17(20(21,22)23)8-18(24)27-19)15-7-13-14(10-28-16(13)9-25-15)12-5-3-2-4-6-12/h2-11H,1H3,(H2,24,26,27).
What are the key properties of 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine?
2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 416.43 g/mol, XLogP of 5.74, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-phenylfuro[2,3-c]pyridin-5-yl)ethylsulfanyl]-6-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 18799673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).